C15H25ClN2O2S — CID 176918998
ethane;ethyl 1-(4-chloro-2-methylsulfanylpyrimidin-5-yl)cyclopropane-1-carboxylate (PubChem CID 176918998) has the molecular formula C15H25ClN2O2S and a molecular weight of 332.90 g/mol. Its IUPAC name is ethane;ethyl 1-(4-chloro-2-methylsulfanylpyrimidin-5-yl)cyclopropane-1-carboxylate.
| Compound Name | ethane;ethyl 1-(4-chloro-2-methylsulfanylpyrimidin-5-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 176918998 |
| Molecular Formula | C15H25ClN2O2S |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethane;ethyl 1-(4-chloro-2-methylsulfanylpyrimidin-5-yl)cyclopropane-1-carboxylate |
| SMILES | CC.CC.CCOC(=O)C1(c2cnc(SC)nc2Cl)CC1 |
| InChI | InChI=1S/C11H13ClN2O2S.2C2H6/c1-3-16-9(15)11(4-5-11)7-6-13-10(17-2)14-8(7)12;2*1-2/h6H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | FYUOOFHZIWWXMY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |