C9H9ClN2O2S — CID 87323681
prop-2-enyl 4-chloro-2-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 87323681) has the molecular formula C9H9ClN2O2S and a molecular weight of 244.70 g/mol. Its IUPAC name is prop-2-enyl 4-chloro-2-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | prop-2-enyl 4-chloro-2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 87323681 |
| Molecular Formula | C9H9ClN2O2S |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | prop-2-enyl 4-chloro-2-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | C=CCOC(=O)c1cnc(SC)nc1Cl |
| InChI | InChI=1S/C9H9ClN2O2S/c1-3-4-14-8(13)6-5-11-9(15-2)12-7(6)10/h3,5H,1,4H2,2H3 |
| InChIKey | VJEZFXPYBIKADU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|