C20H18ClN3OS — CID 18858760
N,N-dibenzyl-4-chloro-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 18858760) has the molecular formula C20H18ClN3OS and a molecular weight of 383.90 g/mol. Its IUPAC name is N,N-dibenzyl-4-chloro-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | N,N-dibenzyl-4-chloro-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 18858760 |
| Molecular Formula | C20H18ClN3OS |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N,N-dibenzyl-4-chloro-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)N(Cc2ccccc2)Cc2ccccc2)c(Cl)n1 |
| InChI | InChI=1S/C20H18ClN3OS/c1-26-20-22-12-17(18(21)23-20)19(25)24(13-15-8-4-2-5-9-15)14-16-10-6-3-7-11-16/h2-12H,13-14H2,1H3 |
| InChIKey | UIKXZIWDVBJUDL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |