C9H11N3O3S — CID 136661145
ethyl 4-[(E)-hydroxyiminomethyl]-2-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 136661145) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is ethyl 4-[(E)-hydroxyiminomethyl]-2-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[(E)-hydroxyiminomethyl]-2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 136661145 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | ethyl 4-[(E)-hydroxyiminomethyl]-2-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1/C=N/O |
| InChI | InChI=1S/C9H11N3O3S/c1-3-15-8(13)6-4-10-9(16-2)12-7(6)5-11-14/h4-5,14H,3H2,1-2H3/b11-5+ |
| InChIKey | YOZQASPELVELDU-VZUCSPMQSA-N |
| XLogP | 1.18 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|