C16H16N2O3S — CID 71224457
ethyl 2-methylsulfanyl-4-(2-phenylacetyl)pyrimidine-5-carboxylate (PubChem CID 71224457) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-4-(2-phenylacetyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-methylsulfanyl-4-(2-phenylacetyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 71224457 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | ethyl 2-methylsulfanyl-4-(2-phenylacetyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2O3S/c1-3-21-15(20)12-10-17-16(22-2)18-14(12)13(19)9-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | KJBFGGWEWLKOQW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |