C16H14ClFN2O2S — CID 171524428
ethyl 4-[1-(3-chloro-2-fluorophenyl)ethenyl]-2-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 171524428) has the molecular formula C16H14ClFN2O2S and a molecular weight of 352.82 g/mol. Its IUPAC name is ethyl 4-[1-(3-chloro-2-fluorophenyl)ethenyl]-2-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[1-(3-chloro-2-fluorophenyl)ethenyl]-2-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 171524428 |
| Molecular Formula | C16H14ClFN2O2S |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | ethyl 4-[1-(3-chloro-2-fluorophenyl)ethenyl]-2-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | C=C(c1cccc(Cl)c1F)c1nc(SC)ncc1C(=O)OCC |
| InChI | InChI=1S/C16H14ClFN2O2S/c1-4-22-15(21)11-8-19-16(23-3)20-14(11)9(2)10-6-5-7-12(17)13(10)18/h5-8H,2,4H2,1,3H3 |
| InChIKey | JFBRIEPBMPIRPV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |