C10H17N5O2 — CID 176921048
[hydroxy(methyl)amino]-(5-methanimidoyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methanol (PubChem CID 176921048) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is [hydroxy(methyl)amino]-(5-methanimidoyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methanol.
| Compound Name | [hydroxy(methyl)amino]-(5-methanimidoyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methanol |
|---|---|
| PubChem CID | 176921048 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | [hydroxy(methyl)amino]-(5-methanimidoyl-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl)methanol |
| SMILES | [H]/N=C/N1CCCn2nc(C(O)N(C)O)cc2C1 |
| InChI | InChI=1S/C10H17N5O2/c1-13(17)10(16)9-5-8-6-14(7-11)3-2-4-15(8)12-9/h5,7,10-11,16-17H,2-4,6H2,1H3/b11-7+ |
| InChIKey | HSEMVXLHMGTYFG-YRNVUSSQSA-N |
| XLogP | 0.01 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|