C12H23KN2O — CID 176921101
potassium N-(1,2,3,5,6,7-hexahydropyrrolizin-8-id-3-ylmethyl)-2-methoxy-N-methylethanamine (PubChem CID 176921101) has the molecular formula C12H23KN2O and a molecular weight of 250.43 g/mol. Its IUPAC name is potassium N-(1,2,3,5,6,7-hexahydropyrrolizin-8-id-3-ylmethyl)-2-methoxy-N-methylethanamine.
| Compound Name | potassium N-(1,2,3,5,6,7-hexahydropyrrolizin-8-id-3-ylmethyl)-2-methoxy-N-methylethanamine |
|---|---|
| PubChem CID | 176921101 |
| Molecular Formula | C12H23KN2O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | potassium N-(1,2,3,5,6,7-hexahydropyrrolizin-8-id-3-ylmethyl)-2-methoxy-N-methylethanamine |
| SMILES | COCCN(C)CC1CC[C-]2CCCN21.[K+] |
| InChI | InChI=1S/C12H23N2O.K/c1-13(8-9-15-2)10-12-6-5-11-4-3-7-14(11)12;/h12H,3-10H2,1-2H3;/q-1;+1 |
| InChIKey | WUTXOCKOBGATBW-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|