C18H25F3N2O — CID 176921145
N-[(Z)-4-methyl-1-piperidin-4-ylpent-2-en-3-yl]-4-(trifluoromethoxy)aniline (PubChem CID 176921145) has the molecular formula C18H25F3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is N-[(Z)-4-methyl-1-piperidin-4-ylpent-2-en-3-yl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(Z)-4-methyl-1-piperidin-4-ylpent-2-en-3-yl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 176921145 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[(Z)-4-methyl-1-piperidin-4-ylpent-2-en-3-yl]-4-(trifluoromethoxy)aniline |
| SMILES | CC(C)/C(=C/CC1CCNCC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H25F3N2O/c1-13(2)17(8-3-14-9-11-22-12-10-14)23-15-4-6-16(7-5-15)24-18(19,20)21/h4-8,13-14,22-23H,3,9-12H2,1-2H3/b17-8- |
| InChIKey | AIWFNKZTWOVXHD-IUXPMGMMSA-N |
| XLogP | 4.93 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |