C20H30F2N3P — CID 176921466
1-[4-[difluoro(phosphanyl)methyl]phenyl]-5-methyl-N-(3-methylpentyl)-N-propylpyrazol-3-amine (PubChem CID 176921466) has the molecular formula C20H30F2N3P and a molecular weight of 381.45 g/mol. Its IUPAC name is 1-[4-[difluoro(phosphanyl)methyl]phenyl]-5-methyl-N-(3-methylpentyl)-N-propylpyrazol-3-amine.
| Compound Name | 1-[4-[difluoro(phosphanyl)methyl]phenyl]-5-methyl-N-(3-methylpentyl)-N-propylpyrazol-3-amine |
|---|---|
| PubChem CID | 176921466 |
| Molecular Formula | C20H30F2N3P |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[4-[difluoro(phosphanyl)methyl]phenyl]-5-methyl-N-(3-methylpentyl)-N-propylpyrazol-3-amine |
| SMILES | CCCN(CCC(C)CC)c1cc(C)n(-c2ccc(C(F)(F)P)cc2)n1 |
| InChI | InChI=1S/C20H30F2N3P/c1-5-12-24(13-11-15(3)6-2)19-14-16(4)25(23-19)18-9-7-17(8-10-18)20(21,22)26/h7-10,14-15H,5-6,11-13,26H2,1-4H3 |
| InChIKey | IYMZIYGCNRWSSS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|