C37H50FN6O3PbS — CID 176924284
CID 176924284 (PubChem CID 176924284) has the molecular formula C37H50FN6O3PbS and a molecular weight of 885.11 g/mol.
| Compound Name | CID 176924284 |
|---|---|
| PubChem CID | 176924284 |
| Molecular Formula | C37H50FN6O3PbS |
| Molecular Weight | 885.11 g/mol |
| Exact Mass | 885.34 |
| IUPAC Name | — |
| SMILES | CC.CCN(C(=O)c1cc(F)ccc1Oc1cncnc1N1CC2(CC(Oc3ccnc4c3C(CCCSC)N(C[Pb])CC4)C2)C1)C(C)C |
| InChI | InChI=1S/C35H44FN6O3S.C2H6.Pb/c1-6-42(23(2)3)34(43)26-16-24(36)9-10-29(26)45-31-19-37-22-39-33(31)41-20-35(21-41)17-25(18-35)44-30-11-13-38-27-12-14-40(4)28(32(27)30)8-7-15-46-5;1-2;/h9-11,13,16,19,22-23,25,28H,4,6-8,12,14-15,17-18,20-21H2,1-3,5H3;1-2H3; |
| InChIKey | SKLGVIHMHUOLNK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 83.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.11 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|