C34H38F3N6O4Pb — CID 176925264
CID 176925264 (PubChem CID 176925264) has the molecular formula C34H38F3N6O4Pb and a molecular weight of 858.91 g/mol.
| Compound Name | CID 176925264 |
|---|---|
| PubChem CID | 176925264 |
| Molecular Formula | C34H38F3N6O4Pb |
| Molecular Weight | 858.91 g/mol |
| Exact Mass | 859.27 |
| IUPAC Name | — |
| SMILES | CC(C)N(C(=O)c1cc(F)ccc1Oc1cncnc1N1CC2(CC(Oc3ccnc4c3C(CO)N(C[Pb])CC4)C2)C1)C1CC(F)(F)C1 |
| InChI | InChI=1S/C34H38F3N6O4.Pb/c1-20(2)43(22-11-34(36,37)12-22)32(45)24-10-21(35)4-5-27(24)47-29-15-38-19-40-31(29)42-17-33(18-42)13-23(14-33)46-28-6-8-39-25-7-9-41(3)26(16-44)30(25)28;/h4-6,8,10,15,19-20,22-23,26,44H,3,7,9,11-14,16-18H2,1-2H3; |
| InChIKey | ZLDFEFIVTVCZNW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.91 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |