C25H44N3 — CID 176925739
CID 176925739 (PubChem CID 176925739) has the molecular formula C25H44N3 and a molecular weight of 386.65 g/mol.
| Compound Name | CID 176925739 |
|---|---|
| PubChem CID | 176925739 |
| Molecular Formula | C25H44N3 |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | — |
| SMILES | CCCN(C[C@@H](C1=C[CH]1)C(C)C)C1CC2(CCN(CC3CCNCC3)CC2)C1 |
| InChI | InChI=1S/C25H44N3/c1-4-13-28(19-24(20(2)3)22-5-6-22)23-16-25(17-23)9-14-27(15-10-25)18-21-7-11-26-12-8-21/h5-6,20-21,23-24,26H,4,7-19H2,1-3H3/t24-/m1/s1 |
| InChIKey | FGUJUPJAAFWIIH-XMMPIXPASA-N |
| XLogP | 4.36 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |