C25H37FN2 — CID 176927064
(5Z,6Z)-5-[1-(ethylideneamino)ethylidene]-N-[3-(4-fluorophenyl)propyl]-3-methylundeca-3,6-dien-4-amine (PubChem CID 176927064) has the molecular formula C25H37FN2 and a molecular weight of 384.58 g/mol. Its IUPAC name is (5Z,6Z)-5-[1-(ethylideneamino)ethylidene]-N-[3-(4-fluorophenyl)propyl]-3-methylundeca-3,6-dien-4-amine.
| Compound Name | (5Z,6Z)-5-[1-(ethylideneamino)ethylidene]-N-[3-(4-fluorophenyl)propyl]-3-methylundeca-3,6-dien-4-amine |
|---|---|
| PubChem CID | 176927064 |
| Molecular Formula | C25H37FN2 |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (5Z,6Z)-5-[1-(ethylideneamino)ethylidene]-N-[3-(4-fluorophenyl)propyl]-3-methylundeca-3,6-dien-4-amine |
| SMILES | C/C=N/C(C)=C(/C=C\CCCC)C(NCCCc1ccc(F)cc1)=C(C)CC |
| InChI | InChI=1S/C25H37FN2/c1-6-9-10-11-14-24(21(5)27-8-3)25(20(4)7-2)28-19-12-13-22-15-17-23(26)18-16-22/h8,11,14-18,28H,6-7,9-10,12-13,19H2,1-5H3/b14-11-,24-21-,25-20?,27-8+ |
| InChIKey | JAOVTBRYVZKKQF-PGZBWWBJSA-N |
| XLogP | 7.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|