About ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine
ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine (PubChem CID 176927601) has the molecular formula C17H38N2O3
and a molecular weight of 318.50 g/mol. Its IUPAC name is ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine.
Molecular Properties
| Compound Name | ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine |
| PubChem CID | 176927601 |
| Molecular Formula | C17H38N2O3 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine |
| SMILES | CC.CN1CCC(OCCN2CCOCC2)C1.COC(C)C |
| InChI | InChI=1S/C11H22N2O2.C4H10O.C2H6/c1-12-3-2-11(10-12)15-9-6-13-4-7-14-8-5-13;1-4(2)5-3;1-2/h11H,2-10H2,1H3;4H,1-3H3;1-2H3 |
| InChIKey | ACEXOXHUFSXHJH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine?
The IUPAC name of ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine (CID 176927601) is ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine.
What is the SMILES notation for ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine?
The canonical SMILES for ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine is CC.CN1CCC(OCCN2CCOCC2)C1.COC(C)C.
What is the InChIKey of ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine?
The InChIKey is ACEXOXHUFSXHJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2.C4H10O.C2H6/c1-12-3-2-11(10-12)15-9-6-13-4-7-14-8-5-13;1-4(2)5-3;1-2/h11H,2-10H2,1H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine?
ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine has a molecular weight of 318.50 g/mol, XLogP of 2.11, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxypropane;4-[2-(1-methylpyrrolidin-3-yl)oxyethyl]morpholine is sourced from PubChem (CID 176927601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).