C24H30N2O4 — CID 176929899
5-[[4-[(3-formylazetidin-1-yl)methyl]-3-methylphenoxy]methyl]-2-propan-2-yloxybenzonitrile;methanol (PubChem CID 176929899) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 5-[[4-[(3-formylazetidin-1-yl)methyl]-3-methylphenoxy]methyl]-2-propan-2-yloxybenzonitrile;methanol.
| Compound Name | 5-[[4-[(3-formylazetidin-1-yl)methyl]-3-methylphenoxy]methyl]-2-propan-2-yloxybenzonitrile;methanol |
|---|---|
| PubChem CID | 176929899 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 5-[[4-[(3-formylazetidin-1-yl)methyl]-3-methylphenoxy]methyl]-2-propan-2-yloxybenzonitrile;methanol |
| SMILES | CO.Cc1cc(OCc2ccc(OC(C)C)c(C#N)c2)ccc1CN1CC(C=O)C1 |
| InChI | InChI=1S/C23H26N2O3.CH4O/c1-16(2)28-23-7-4-18(9-21(23)10-24)15-27-22-6-5-20(17(3)8-22)13-25-11-19(12-25)14-26;1-2/h4-9,14,16,19H,11-13,15H2,1-3H3;2H,1H3 |
| InChIKey | WRGXMFJRXFPGSN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|