C25H32ClNO3 — CID 176930477
1-[[4-[(3-chloro-4-cyclohexylphenyl)methoxy]phenyl]methyl]azetidine-3-carbaldehyde;methanol (PubChem CID 176930477) has the molecular formula C25H32ClNO3 and a molecular weight of 429.99 g/mol. Its IUPAC name is 1-[[4-[(3-chloro-4-cyclohexylphenyl)methoxy]phenyl]methyl]azetidine-3-carbaldehyde;methanol.
| Compound Name | 1-[[4-[(3-chloro-4-cyclohexylphenyl)methoxy]phenyl]methyl]azetidine-3-carbaldehyde;methanol |
|---|---|
| PubChem CID | 176930477 |
| Molecular Formula | C25H32ClNO3 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[[4-[(3-chloro-4-cyclohexylphenyl)methoxy]phenyl]methyl]azetidine-3-carbaldehyde;methanol |
| SMILES | CO.O=CC1CN(Cc2ccc(OCc3ccc(C4CCCCC4)c(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C24H28ClNO2.CH4O/c25-24-12-19(8-11-23(24)21-4-2-1-3-5-21)17-28-22-9-6-18(7-10-22)13-26-14-20(15-26)16-27;1-2/h6-12,16,20-21H,1-5,13-15,17H2;2H,1H3 |
| InChIKey | LJZBXPAFEFNEOK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|