About 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile
2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile (PubChem CID 176929996) has the molecular formula C7H7ClN2
and a molecular weight of 154.60 g/mol. Its IUPAC name is 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile.
Molecular Properties
| Compound Name | 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile |
| PubChem CID | 176929996 |
| Molecular Formula | C7H7ClN2 |
| Molecular Weight | 154.60 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile |
| SMILES | N#CC1=NC(CCl)CC=C1 |
| InChI | InChI=1S/C7H7ClN2/c8-4-6-2-1-3-7(5-9)10-6/h1,3,6H,2,4H2 |
| InChIKey | JGNPHEPTDWHPIL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.60 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile?
The IUPAC name of 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile (CID 176929996) is 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile.
What is the SMILES notation for 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile?
The canonical SMILES for 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile is N#CC1=NC(CCl)CC=C1.
What is the InChIKey of 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile?
The InChIKey is JGNPHEPTDWHPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2/c8-4-6-2-1-3-7(5-9)10-6/h1,3,6H,2,4H2.
What are the key properties of 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile?
2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile has a molecular weight of 154.60 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-2,3-dihydropyridine-6-carbonitrile is sourced from PubChem (CID 176929996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).