C7H9Cl2N — CID 164992682
2,6-bis(chloromethyl)-2,3-dihydropyridine (PubChem CID 164992682) has the molecular formula C7H9Cl2N and a molecular weight of 178.06 g/mol. Its IUPAC name is 2,6-bis(chloromethyl)-2,3-dihydropyridine.
| Compound Name | 2,6-bis(chloromethyl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 164992682 |
| Molecular Formula | C7H9Cl2N |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 2,6-bis(chloromethyl)-2,3-dihydropyridine |
| SMILES | ClCC1=NC(CCl)CC=C1 |
| InChI | InChI=1S/C7H9Cl2N/c8-4-6-2-1-3-7(5-9)10-6/h1-2,7H,3-5H2 |
| InChIKey | HBXJDQGDBZKSCW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|