About [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine
[2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine (PubChem CID 176930576) has the molecular formula C7H9ClN2
and a molecular weight of 156.62 g/mol. Its IUPAC name is [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine.
Molecular Properties
| Compound Name | [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine |
| PubChem CID | 176930576 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine |
| SMILES | [H]/N=C/C1=NC(CCl)CC=C1 |
| InChI | InChI=1S/C7H9ClN2/c8-4-6-2-1-3-7(5-9)10-6/h1,3,5-6,9H,2,4H2/b9-5+ |
| InChIKey | GERMPFYVHNKAFD-WEVVVXLNSA-N |
| XLogP | 1.64 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine?
The IUPAC name of [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine (CID 176930576) is [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine.
What is the SMILES notation for [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine?
The canonical SMILES for [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine is [H]/N=C/C1=NC(CCl)CC=C1.
What is the InChIKey of [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine?
The InChIKey is GERMPFYVHNKAFD-WEVVVXLNSA-N. The full InChI is InChI=1S/C7H9ClN2/c8-4-6-2-1-3-7(5-9)10-6/h1,3,5-6,9H,2,4H2/b9-5+.
What are the key properties of [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine?
[2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine has a molecular weight of 156.62 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(chloromethyl)-2,3-dihydropyridin-6-yl]methanimine is sourced from PubChem (CID 176930576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).