About ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate
ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate (PubChem CID 176933042) has the molecular formula C19H31FO3
and a molecular weight of 326.45 g/mol. Its IUPAC name is ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate.
Molecular Properties
| Compound Name | ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate |
| PubChem CID | 176933042 |
| Molecular Formula | C19H31FO3 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate |
| SMILES | CC.CCC(=O)OCCCCc1cccc(OCC(C)C)c1F |
| InChI | InChI=1S/C17H25FO3.C2H6/c1-4-16(19)20-11-6-5-8-14-9-7-10-15(17(14)18)21-12-13(2)3;1-2/h7,9-10,13H,4-6,8,11-12H2,1-3H3;1-2H3 |
| InChIKey | HDYZXHBFFWRCJS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate?
The IUPAC name of ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate (CID 176933042) is ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate.
What is the SMILES notation for ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate?
The canonical SMILES for ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate is CC.CCC(=O)OCCCCc1cccc(OCC(C)C)c1F.
What is the InChIKey of ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate?
The InChIKey is HDYZXHBFFWRCJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25FO3.C2H6/c1-4-16(19)20-11-6-5-8-14-9-7-10-15(17(14)18)21-12-13(2)3;1-2/h7,9-10,13H,4-6,8,11-12H2,1-3H3;1-2H3.
What are the key properties of ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate?
ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate has a molecular weight of 326.45 g/mol, XLogP of 5.16, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[2-fluoro-3-(2-methylpropoxy)phenyl]butyl propanoate is sourced from PubChem (CID 176933042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).