C14H23NO — CID 83932463
4-[2-(2-methylpropoxy)phenyl]butan-1-amine (PubChem CID 83932463) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-[2-(2-methylpropoxy)phenyl]butan-1-amine.
| Compound Name | 4-[2-(2-methylpropoxy)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 83932463 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-[2-(2-methylpropoxy)phenyl]butan-1-amine |
| SMILES | CC(C)COc1ccccc1CCCCN |
| InChI | InChI=1S/C14H23NO/c1-12(2)11-16-14-9-4-3-7-13(14)8-5-6-10-15/h3-4,7,9,12H,5-6,8,10-11,15H2,1-2H3 |
| InChIKey | YDRGBUAPGDHHHP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|