C11H15F2NO — CID 117306539
4-[2-(difluoromethoxy)phenyl]butan-1-amine (PubChem CID 117306539) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 4-[2-(difluoromethoxy)phenyl]butan-1-amine.
| Compound Name | 4-[2-(difluoromethoxy)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 117306539 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4-[2-(difluoromethoxy)phenyl]butan-1-amine |
| SMILES | NCCCCc1ccccc1OC(F)F |
| InChI | InChI=1S/C11H15F2NO/c12-11(13)15-10-7-2-1-5-9(10)6-3-4-8-14/h1-2,5,7,11H,3-4,6,8,14H2 |
| InChIKey | ZKGHHHJKVMHRRU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|