C10H13F2N3O — CID 110062319
2-[2-[2-(difluoromethoxy)phenyl]ethyl]guanidine (PubChem CID 110062319) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-[2-[2-(difluoromethoxy)phenyl]ethyl]guanidine.
| Compound Name | 2-[2-[2-(difluoromethoxy)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 110062319 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-[2-[2-(difluoromethoxy)phenyl]ethyl]guanidine |
| SMILES | NC(N)=NCCc1ccccc1OC(F)F |
| InChI | InChI=1S/C10H13F2N3O/c11-9(12)16-8-4-2-1-3-7(8)5-6-15-10(13)14/h1-4,9H,5-6H2,(H4,13,14,15) |
| InChIKey | DUPNOBJUDJARAE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|