C14H21F2N3O — CID 110062385
2-[2-[2-(difluoromethoxy)phenyl]ethyl]-1,1-diethylguanidine (PubChem CID 110062385) has the molecular formula C14H21F2N3O and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[2-[2-(difluoromethoxy)phenyl]ethyl]-1,1-diethylguanidine.
| Compound Name | 2-[2-[2-(difluoromethoxy)phenyl]ethyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 110062385 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[2-[2-(difluoromethoxy)phenyl]ethyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CCc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H21F2N3O/c1-3-19(4-2)14(17)18-10-9-11-7-5-6-8-12(11)20-13(15)16/h5-8,13H,3-4,9-10H2,1-2H3,(H2,17,18) |
| InChIKey | ZJVCCRQKRQBZFG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|