C26H26BrF5N4O2 — CID 176933117
3-[6-[4-[(4R)-4-(4-bromo-2,3-difluorophenyl)-3,3-difluoropiperidin-1-yl]piperidin-1-yl]-5-fluoro-3-pyridinyl]piperidine-2,6-dione (PubChem CID 176933117) has the molecular formula C26H26BrF5N4O2 and a molecular weight of 601.41 g/mol. Its IUPAC name is 3-[6-[4-[(4R)-4-(4-bromo-2,3-difluorophenyl)-3,3-difluoropiperidin-1-yl]piperidin-1-yl]-5-fluoro-3-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[(4R)-4-(4-bromo-2,3-difluorophenyl)-3,3-difluoropiperidin-1-yl]piperidin-1-yl]-5-fluoro-3-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176933117 |
| Molecular Formula | C26H26BrF5N4O2 |
| Molecular Weight | 601.41 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | 3-[6-[4-[(4R)-4-(4-bromo-2,3-difluorophenyl)-3,3-difluoropiperidin-1-yl]piperidin-1-yl]-5-fluoro-3-pyridinyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cnc(N3CCC(N4CC[C@H](c5ccc(Br)c(F)c5F)C(F)(F)C4)CC3)c(F)c2)C(=O)N1 |
| InChI | InChI=1S/C26H26BrF5N4O2/c27-19-3-1-17(22(29)23(19)30)18-7-10-36(13-26(18,31)32)15-5-8-35(9-6-15)24-20(28)11-14(12-33-24)16-2-4-21(37)34-25(16)38/h1,3,11-12,15-16,18H,2,4-10,13H2,(H,34,37,38)/t16?,18-/m1/s1 |
| InChIKey | SLXPEOPDEOPLTG-UHUGOGIASA-N |
| XLogP | 4.88 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|