C6H14N2O2 — CID 176936728
(E,2S)-2,6-diaminohex-5-ene-1,1-diol (PubChem CID 176936728) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (E,2S)-2,6-diaminohex-5-ene-1,1-diol.
| Compound Name | (E,2S)-2,6-diaminohex-5-ene-1,1-diol |
|---|---|
| PubChem CID | 176936728 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (E,2S)-2,6-diaminohex-5-ene-1,1-diol |
| SMILES | N/C=C/CC[C@H](N)C(O)O |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h2,4-6,9-10H,1,3,7-8H2/b4-2+/t5-/m0/s1 |
| InChIKey | QMVSIJZGGJMXPU-FYTLMZHYSA-N |
| XLogP | -1.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|