C10H19NS — CID 176938142
ethane;5-ethyl-3-propan-2-yl-1,2-thiazole (PubChem CID 176938142) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is ethane;5-ethyl-3-propan-2-yl-1,2-thiazole.
| Compound Name | ethane;5-ethyl-3-propan-2-yl-1,2-thiazole |
|---|---|
| PubChem CID | 176938142 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | ethane;5-ethyl-3-propan-2-yl-1,2-thiazole |
| SMILES | CC.CCc1cc(C(C)C)ns1 |
| InChI | InChI=1S/C8H13NS.C2H6/c1-4-7-5-8(6(2)3)9-10-7;1-2/h5-6H,4H2,1-3H3;1-2H3 |
| InChIKey | PPCAXQQEPIRVJB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |