About 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide
6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide (PubChem CID 176939886) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide.
Molecular Properties
| Compound Name | 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide |
| PubChem CID | 176939886 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide |
| SMILES | CC1CC2(CCN1)CS(=O)C2 |
| InChI | InChI=1S/C8H15NOS/c1-7-4-8(2-3-9-7)5-11(10)6-8/h7,9H,2-6H2,1H3 |
| InChIKey | KVENDEUMGUPMQG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide?
The IUPAC name of 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide (CID 176939886) is 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide.
What is the SMILES notation for 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide?
The canonical SMILES for 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide is CC1CC2(CCN1)CS(=O)C2.
What is the InChIKey of 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide?
The InChIKey is KVENDEUMGUPMQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NOS/c1-7-4-8(2-3-9-7)5-11(10)6-8/h7,9H,2-6H2,1H3.
What are the key properties of 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide?
6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide has a molecular weight of 173.28 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2λ4-thia-7-azaspiro[3.5]nonane 2-oxide is sourced from PubChem (CID 176939886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).