C15H16N2 — CID 176940262
(Z)-1-[2-(1-ethynylcyclopropyl)-5-methylphenyl]-3-iminoprop-1-en-1-amine (PubChem CID 176940262) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is (Z)-1-[2-(1-ethynylcyclopropyl)-5-methylphenyl]-3-iminoprop-1-en-1-amine.
| Compound Name | (Z)-1-[2-(1-ethynylcyclopropyl)-5-methylphenyl]-3-iminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 176940262 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (Z)-1-[2-(1-ethynylcyclopropyl)-5-methylphenyl]-3-iminoprop-1-en-1-amine |
| SMILES | [H]/N=C/C=C(\N)c1cc(C)ccc1C1(C#C)CC1 |
| InChI | InChI=1S/C15H16N2/c1-3-15(7-8-15)13-5-4-11(2)10-12(13)14(17)6-9-16/h1,4-6,9-10,16H,7-8,17H2,2H3/b14-6-,16-9+ |
| InChIKey | JFLFEDPWVPZSAO-JFJNRIKNSA-N |
| XLogP | 2.61 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|