C35H39F6NO4 — CID 176941662
(10S,13S)-N-[bis[4-(trifluoromethoxy)phenyl]methyl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 176941662) has the molecular formula C35H39F6NO4 and a molecular weight of 651.69 g/mol. Its IUPAC name is (10S,13S)-N-[bis[4-(trifluoromethoxy)phenyl]methyl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (10S,13S)-N-[bis[4-(trifluoromethoxy)phenyl]methyl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 176941662 |
| Molecular Formula | C35H39F6NO4 |
| Molecular Weight | 651.69 g/mol |
| Exact Mass | 651.28 |
| IUPAC Name | (10S,13S)-N-[bis[4-(trifluoromethoxy)phenyl]methyl]-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | C[C@]12CCC(=O)CC1CCC1C2CC[C@]2(C)C(C(=O)NC(c3ccc(OC(F)(F)F)cc3)c3ccc(OC(F)(F)F)cc3)CCC12 |
| InChI | InChI=1S/C35H39F6NO4/c1-32-17-15-23(43)19-22(32)7-12-26-27-13-14-29(33(27,2)18-16-28(26)32)31(44)42-30(20-3-8-24(9-4-20)45-34(36,37)38)21-5-10-25(11-6-21)46-35(39,40)41/h3-6,8-11,22,26-30H,7,12-19H2,1-2H3,(H,42,44)/t22?,26?,27?,28?,29?,32-,33-/m0/s1 |
| InChIKey | OTBAEUNMRYMVEE-VMMVRGJWSA-N |
| XLogP | 8.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.69 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |