C16H39N — CID 176942573
3,5-dimethyl-2-propan-2-ylpiperidine;ethane (PubChem CID 176942573) has the molecular formula C16H39N and a molecular weight of 245.49 g/mol. Its IUPAC name is 3,5-dimethyl-2-propan-2-ylpiperidine;ethane.
| Compound Name | 3,5-dimethyl-2-propan-2-ylpiperidine;ethane |
|---|---|
| PubChem CID | 176942573 |
| Molecular Formula | C16H39N |
| Molecular Weight | 245.49 g/mol |
| Exact Mass | 245.31 |
| IUPAC Name | 3,5-dimethyl-2-propan-2-ylpiperidine;ethane |
| SMILES | CC.CC.CC.CC1CNC(C(C)C)C(C)C1 |
| InChI | InChI=1S/C10H21N.3C2H6/c1-7(2)10-9(4)5-8(3)6-11-10;3*1-2/h7-11H,5-6H2,1-4H3;3*1-2H3 |
| InChIKey | RVCFMZITKSTIOY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |