C14H33N2+ — CID 176944058
N,3-dimethyl-3-(1-methylpiperidin-1-ium-1-yl)butan-1-amine;ethane (PubChem CID 176944058) has the molecular formula C14H33N2+ and a molecular weight of 229.43 g/mol. Its IUPAC name is N,3-dimethyl-3-(1-methylpiperidin-1-ium-1-yl)butan-1-amine;ethane.
| Compound Name | N,3-dimethyl-3-(1-methylpiperidin-1-ium-1-yl)butan-1-amine;ethane |
|---|---|
| PubChem CID | 176944058 |
| Molecular Formula | C14H33N2+ |
| Molecular Weight | 229.43 g/mol |
| Exact Mass | 229.26 |
| IUPAC Name | N,3-dimethyl-3-(1-methylpiperidin-1-ium-1-yl)butan-1-amine;ethane |
| SMILES | CC.CNCCC(C)(C)[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C12H27N2.C2H6/c1-12(2,8-9-13-3)14(4)10-6-5-7-11-14;1-2/h13H,5-11H2,1-4H3;1-2H3/q+1; |
| InChIKey | NPVKBLLSZZMGNB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|