C15H17N7O2 — CID 176944539
2-[(4-amino-1-ethyl-3-methylpyrazole-5-carbonyl)amino]-3H-benzimidazole-5-carboxamide (PubChem CID 176944539) has the molecular formula C15H17N7O2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-[(4-amino-1-ethyl-3-methylpyrazole-5-carbonyl)amino]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[(4-amino-1-ethyl-3-methylpyrazole-5-carbonyl)amino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 176944539 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-[(4-amino-1-ethyl-3-methylpyrazole-5-carbonyl)amino]-3H-benzimidazole-5-carboxamide |
| SMILES | CCn1nc(C)c(N)c1C(=O)Nc1nc2ccc(C(N)=O)cc2[nH]1 |
| InChI | InChI=1S/C15H17N7O2/c1-3-22-12(11(16)7(2)21-22)14(24)20-15-18-9-5-4-8(13(17)23)6-10(9)19-15/h4-6H,3,16H2,1-2H3,(H2,17,23)(H2,18,19,20,24) |
| InChIKey | KWOUBUPWLGDFDL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |