C25H25ClF2N8O3 — CID 176947164
1-amino-1-(2-amino-2-fluoroethyl)-3-[12-chloro-13-(2-cyano-6-hydroxyphenyl)-14-fluoro-10-oxa-2,16,18-triazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19),16-pentaen-5-yl]urea (PubChem CID 176947164) has the molecular formula C25H25ClF2N8O3 and a molecular weight of 558.98 g/mol. Its IUPAC name is 1-amino-1-(2-amino-2-fluoroethyl)-3-[12-chloro-13-(2-cyano-6-hydroxyphenyl)-14-fluoro-10-oxa-2,16,18-triazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19),16-pentaen-5-yl]urea.
| Compound Name | 1-amino-1-(2-amino-2-fluoroethyl)-3-[12-chloro-13-(2-cyano-6-hydroxyphenyl)-14-fluoro-10-oxa-2,16,18-triazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19),16-pentaen-5-yl]urea |
|---|---|
| PubChem CID | 176947164 |
| Molecular Formula | C25H25ClF2N8O3 |
| Molecular Weight | 558.98 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 1-amino-1-(2-amino-2-fluoroethyl)-3-[12-chloro-13-(2-cyano-6-hydroxyphenyl)-14-fluoro-10-oxa-2,16,18-triazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19),16-pentaen-5-yl]urea |
| SMILES | N#Cc1cccc(O)c1-c1c(Cl)c2c3c(ncnc3c1F)N1CCC(NC(=O)N(N)CC(N)F)CC1CCO2 |
| InChI | InChI=1S/C25H25ClF2N8O3/c26-20-18(17-12(9-29)2-1-3-15(17)37)21(28)22-19-23(20)39-7-5-14-8-13(34-25(38)36(31)10-16(27)30)4-6-35(14)24(19)33-11-32-22/h1-3,11,13-14,16,37H,4-8,10,30-31H2,(H,34,38) |
| InChIKey | ONIOBDKVSSMDRY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 166.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|