C25H24ClF2N5O5 — CID 153361572
tert-butyl (7S)-11-chloro-13-fluoro-12-(6-fluoro-2-methyl-3-nitrophenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate (PubChem CID 153361572) has the molecular formula C25H24ClF2N5O5 and a molecular weight of 547.95 g/mol. Its IUPAC name is tert-butyl (7S)-11-chloro-13-fluoro-12-(6-fluoro-2-methyl-3-nitrophenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate.
| Compound Name | tert-butyl (7S)-11-chloro-13-fluoro-12-(6-fluoro-2-methyl-3-nitrophenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 153361572 |
| Molecular Formula | C25H24ClF2N5O5 |
| Molecular Weight | 547.95 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | tert-butyl (7S)-11-chloro-13-fluoro-12-(6-fluoro-2-methyl-3-nitrophenyl)-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
| SMILES | Cc1c([N+](=O)[O-])ccc(F)c1-c1c(Cl)c2c3c(ncnc3c1F)N1CCN(C(=O)OC(C)(C)C)C[C@H]1CO2 |
| InChI | InChI=1S/C25H24ClF2N5O5/c1-12-15(33(35)36)6-5-14(27)16(12)17-19(26)22-18-21(20(17)28)29-11-30-23(18)32-8-7-31(9-13(32)10-37-22)24(34)38-25(2,3)4/h5-6,11,13H,7-10H2,1-4H3/t13-/m0/s1 |
| InChIKey | XPMKUBJBVXSSNY-ZDUSSCGKSA-N |
| XLogP | 5.26 |
| TPSA | 110.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.95 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|