C7H13NO2U — CID 176948121
2-ethyl-2-(methylamino)butanoic acid;uranium(2+) (PubChem CID 176948121) has the molecular formula C7H13NO2U and a molecular weight of 381.22 g/mol. Its IUPAC name is 2-ethyl-2-(methylamino)butanoic acid;uranium(2+).
| Compound Name | 2-ethyl-2-(methylamino)butanoic acid;uranium(2+) |
|---|---|
| PubChem CID | 176948121 |
| Molecular Formula | C7H13NO2U |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-ethyl-2-(methylamino)butanoic acid;uranium(2+) |
| SMILES | [CH2-]CC(C[CH2-])(NC)C(=O)O.[U+2] |
| InChI | InChI=1S/C7H13NO2.U/c1-4-7(5-2,8-3)6(9)10;/h8H,1-2,4-5H2,3H3,(H,9,10);/q-2;+2 |
| InChIKey | JYGXFDYGPSLKJC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|