C15H29N3O5 — CID 176948727
3-[2-[2-[[2-(propan-2-ylideneamino)oxyacetyl]amino]ethoxy]ethoxy]-N-propylpropanamide (PubChem CID 176948727) has the molecular formula C15H29N3O5 and a molecular weight of 331.41 g/mol. Its IUPAC name is 3-[2-[2-[[2-(propan-2-ylideneamino)oxyacetyl]amino]ethoxy]ethoxy]-N-propylpropanamide.
| Compound Name | 3-[2-[2-[[2-(propan-2-ylideneamino)oxyacetyl]amino]ethoxy]ethoxy]-N-propylpropanamide |
|---|---|
| PubChem CID | 176948727 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 3-[2-[2-[[2-(propan-2-ylideneamino)oxyacetyl]amino]ethoxy]ethoxy]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCOCCOCCNC(=O)CON=C(C)C |
| InChI | InChI=1S/C15H29N3O5/c1-4-6-16-14(19)5-8-21-10-11-22-9-7-17-15(20)12-23-18-13(2)3/h4-12H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | DSUPHQTUIOENKJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|