C22H27F4N5O4S — CID 176950800
N-(2,2-difluoro-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2-[4,4-difluoro-3-(2-oxo-1,3-diazinan-5-yl)piperidin-1-yl]propanamide;ethane (PubChem CID 176950800) has the molecular formula C22H27F4N5O4S and a molecular weight of 533.55 g/mol. Its IUPAC name is N-(2,2-difluoro-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2-[4,4-difluoro-3-(2-oxo-1,3-diazinan-5-yl)piperidin-1-yl]propanamide;ethane.
| Compound Name | N-(2,2-difluoro-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2-[4,4-difluoro-3-(2-oxo-1,3-diazinan-5-yl)piperidin-1-yl]propanamide;ethane |
|---|---|
| PubChem CID | 176950800 |
| Molecular Formula | C22H27F4N5O4S |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | N-(2,2-difluoro-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2-[4,4-difluoro-3-(2-oxo-1,3-diazinan-5-yl)piperidin-1-yl]propanamide;ethane |
| SMILES | CC.CC(C(=O)Nc1nc2cc3c(cc2s1)OC(F)(F)O3)N1CCC(F)(F)C(C2CNC(=O)NC2)C1 |
| InChI | InChI=1S/C20H21F4N5O4S.C2H6/c1-9(29-3-2-19(21,22)11(8-29)10-6-25-17(31)26-7-10)16(30)28-18-27-12-4-13-14(5-15(12)34-18)33-20(23,24)32-13;1-2/h4-5,9-11H,2-3,6-8H2,1H3,(H2,25,26,31)(H,27,28,30);1-2H3 |
| InChIKey | SUYKDANCJVLQDL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |