C25H28F4N4O6S — CID 176950675
N-(2,2-difluoro-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2-[3-[5-(1,2-dihydroxyethyl)-6-oxo-1H-pyridin-3-yl]-4,4-difluoropiperidin-1-yl]propanamide;ethane (PubChem CID 176950675) has the molecular formula C25H28F4N4O6S and a molecular weight of 588.58 g/mol. Its IUPAC name is N-(2,2-difluoro-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2-[3-[5-(1,2-dihydroxyethyl)-6-oxo-1H-pyridin-3-yl]-4,4-difluoropiperidin-1-yl]propanamide;ethane.
| Compound Name | N-(2,2-difluoro-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2-[3-[5-(1,2-dihydroxyethyl)-6-oxo-1H-pyridin-3-yl]-4,4-difluoropiperidin-1-yl]propanamide;ethane |
|---|---|
| PubChem CID | 176950675 |
| Molecular Formula | C25H28F4N4O6S |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | N-(2,2-difluoro-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-2-[3-[5-(1,2-dihydroxyethyl)-6-oxo-1H-pyridin-3-yl]-4,4-difluoropiperidin-1-yl]propanamide;ethane |
| SMILES | CC.CC(C(=O)Nc1nc2cc3c(cc2s1)OC(F)(F)O3)N1CCC(F)(F)C(c2c[nH]c(=O)c(C(O)CO)c2)C1 |
| InChI | InChI=1S/C23H22F4N4O6S.C2H6/c1-10(19(34)30-21-29-14-5-16-17(6-18(14)38-21)37-23(26,27)36-16)31-3-2-22(24,25)13(8-31)11-4-12(15(33)9-32)20(35)28-7-11;1-2/h4-7,10,13,15,32-33H,2-3,8-9H2,1H3,(H,28,35)(H,29,30,34);1-2H3 |
| InChIKey | ACVWDHLXATTXJW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 137.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |