C27H28FN5O — CID 176950944
4-[2,8-dimethyl-4-(6-methyl-1,4-oxazepan-4-yl)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoro-7,8-dihydronaphthalen-2-amine (PubChem CID 176950944) has the molecular formula C27H28FN5O and a molecular weight of 457.55 g/mol. Its IUPAC name is 4-[2,8-dimethyl-4-(6-methyl-1,4-oxazepan-4-yl)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoro-7,8-dihydronaphthalen-2-amine.
| Compound Name | 4-[2,8-dimethyl-4-(6-methyl-1,4-oxazepan-4-yl)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoro-7,8-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 176950944 |
| Molecular Formula | C27H28FN5O |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 4-[2,8-dimethyl-4-(6-methyl-1,4-oxazepan-4-yl)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoro-7,8-dihydronaphthalen-2-amine |
| SMILES | C#CC1=C(F)CCc2cc(N)cc(-c3ncc4c(N5CCOCC(C)C5)nc(C)nc4c3C)c21 |
| InChI | InChI=1S/C27H28FN5O/c1-5-20-23(28)7-6-18-10-19(29)11-21(24(18)20)25-16(3)26-22(12-30-25)27(32-17(4)31-26)33-8-9-34-14-15(2)13-33/h1,10-12,15H,6-9,13-14,29H2,2-4H3 |
| InChIKey | ZLCSMLYHLLNUGV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|