C13H11ClF2N4O — CID 176951259
(1R,7S)-2-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-5-oxa-2-azabicyclo[5.1.0]octane (PubChem CID 176951259) has the molecular formula C13H11ClF2N4O and a molecular weight of 312.71 g/mol. Its IUPAC name is (1R,7S)-2-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-5-oxa-2-azabicyclo[5.1.0]octane.
| Compound Name | (1R,7S)-2-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-5-oxa-2-azabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 176951259 |
| Molecular Formula | C13H11ClF2N4O |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (1R,7S)-2-(7-chloro-2,8-difluoropyrido[4,3-d]pyrimidin-4-yl)-5-oxa-2-azabicyclo[5.1.0]octane |
| SMILES | Fc1nc(N2CCOC[C@H]3C[C@H]32)c2cnc(Cl)c(F)c2n1 |
| InChI | InChI=1S/C13H11ClF2N4O/c14-11-9(15)10-7(4-17-11)12(19-13(16)18-10)20-1-2-21-5-6-3-8(6)20/h4,6,8H,1-3,5H2/t6-,8-/m1/s1 |
| InChIKey | LZANZHVXWLIHFZ-HTRCEHHLSA-N |
| XLogP | 2.18 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|