C12H22FN — CID 176951733
ethane;(2R,8R)-8-ethyl-2-fluoro-6-methyl-1,2,3,5-tetrahydropyrrolizine (PubChem CID 176951733) has the molecular formula C12H22FN and a molecular weight of 199.31 g/mol. Its IUPAC name is ethane;(2R,8R)-8-ethyl-2-fluoro-6-methyl-1,2,3,5-tetrahydropyrrolizine.
| Compound Name | ethane;(2R,8R)-8-ethyl-2-fluoro-6-methyl-1,2,3,5-tetrahydropyrrolizine |
|---|---|
| PubChem CID | 176951733 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | ethane;(2R,8R)-8-ethyl-2-fluoro-6-methyl-1,2,3,5-tetrahydropyrrolizine |
| SMILES | CC.CC[C@@]12C=C(C)CN1C[C@H](F)C2 |
| InChI | InChI=1S/C10H16FN.C2H6/c1-3-10-4-8(2)6-12(10)7-9(11)5-10;1-2/h4,9H,3,5-7H2,1-2H3;1-2H3/t9-,10+;/m1./s1 |
| InChIKey | DZBPMEUQKOKMMY-UXQCFNEQSA-N |
| XLogP | 3.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|