C5H14N4O — CID 176952165
(Z)-3-(2-aminoethoxy)-2-hydrazinylprop-1-en-1-amine (PubChem CID 176952165) has the molecular formula C5H14N4O and a molecular weight of 146.19 g/mol. Its IUPAC name is (Z)-3-(2-aminoethoxy)-2-hydrazinylprop-1-en-1-amine.
| Compound Name | (Z)-3-(2-aminoethoxy)-2-hydrazinylprop-1-en-1-amine |
|---|---|
| PubChem CID | 176952165 |
| Molecular Formula | C5H14N4O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | (Z)-3-(2-aminoethoxy)-2-hydrazinylprop-1-en-1-amine |
| SMILES | N/C=C(/COCCN)NN |
| InChI | InChI=1S/C5H14N4O/c6-1-2-10-4-5(3-7)9-8/h3,9H,1-2,4,6-8H2/b5-3- |
| InChIKey | AXDBCTBWKAOUFL-HYXAFXHYSA-N |
| XLogP | -1.77 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|