About pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate
pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate (PubChem CID 176952268) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate |
| PubChem CID | 176952268 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate |
| SMILES | O=C(NCC[C@H]1CCCN1)OC1CCNC1 |
| InChI | InChI=1S/C11H21N3O2/c15-11(16-10-4-6-12-8-10)14-7-3-9-2-1-5-13-9/h9-10,12-13H,1-8H2,(H,14,15)/t9-,10?/m1/s1 |
| InChIKey | ZYXUAOAIWXTRNE-YHMJZVADSA-N |
| XLogP | 0.22 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate?
The IUPAC name of pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate (CID 176952268) is pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate.
What is the SMILES notation for pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate?
The canonical SMILES for pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate is O=C(NCC[C@H]1CCCN1)OC1CCNC1.
What is the InChIKey of pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate?
The InChIKey is ZYXUAOAIWXTRNE-YHMJZVADSA-N. The full InChI is InChI=1S/C11H21N3O2/c15-11(16-10-4-6-12-8-10)14-7-3-9-2-1-5-13-9/h9-10,12-13H,1-8H2,(H,14,15)/t9-,10?/m1/s1.
What are the key properties of pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate?
pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate has a molecular weight of 227.31 g/mol, XLogP of 0.22, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-3-yl N-[2-[(2R)-pyrrolidin-2-yl]ethyl]carbamate is sourced from PubChem (CID 176952268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).