C18H21F3N6O5 — CID 176953310
ethyl 5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]pyrazine-2-carboxylate (PubChem CID 176953310) has the molecular formula C18H21F3N6O5 and a molecular weight of 458.40 g/mol. Its IUPAC name is ethyl 5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]pyrazine-2-carboxylate.
| Compound Name | ethyl 5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 176953310 |
| Molecular Formula | C18H21F3N6O5 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | ethyl 5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]pyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)cn1 |
| InChI | InChI=1S/C18H21F3N6O5/c1-2-31-17(30)9-3-24-13(7-23-9)25-4-11-16(29)15(28)10(8-32-11)26-14-6-22-5-12(27-14)18(19,20)21/h3,5-7,10-11,15-16,28-29H,2,4,8H2,1H3,(H,24,25)(H,26,27)/t10-,11+,15+,16-/m0/s1 |
| InChIKey | OGAOLFWHXRDBRQ-TZCMFKBTSA-N |
| XLogP | 0.48 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |