C15H23F3N2O3 — CID 176953319
ethane;2-ethyl-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxane-3,4-diol (PubChem CID 176953319) has the molecular formula C15H23F3N2O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is ethane;2-ethyl-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxane-3,4-diol.
| Compound Name | ethane;2-ethyl-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 176953319 |
| Molecular Formula | C15H23F3N2O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | ethane;2-ethyl-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxane-3,4-diol |
| SMILES | CC.CCC1OCC(Nc2cccc(C(F)(F)F)n2)C(O)C1O |
| InChI | InChI=1S/C13H17F3N2O3.C2H6/c1-2-8-12(20)11(19)7(6-21-8)17-10-5-3-4-9(18-10)13(14,15)16;1-2/h3-5,7-8,11-12,19-20H,2,6H2,1H3,(H,17,18);1-2H3 |
| InChIKey | OEOVLUFRZQTUGK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |