C13H17F3N2O3 — CID 176953551
(2R,3R,4R)-2-ethyl-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxane-3,4-diol (PubChem CID 176953551) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is (2R,3R,4R)-2-ethyl-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-ethyl-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 176953551 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (2R,3R,4R)-2-ethyl-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxane-3,4-diol |
| SMILES | CC[C@H]1OCC(Nc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17F3N2O3/c1-2-8-12(20)11(19)7(6-21-8)17-10-5-3-4-9(18-10)13(14,15)16/h3-5,7-8,11-12,19-20H,2,6H2,1H3,(H,17,18)/t7?,8-,11-,12+/m1/s1 |
| InChIKey | NEEKYCPCBABLJD-MZTOHZFKSA-N |
| XLogP | 1.41 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |