C27H35F2N5O — CID 176954031
N-[(1S)-3-[3-(3,5-dimethyl-1,2,4-triazol-4-yl)-8-azatricyclo[3.2.1.01,4]octan-8-yl]-1-phenylpropyl]-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 176954031) has the molecular formula C27H35F2N5O and a molecular weight of 483.61 g/mol. Its IUPAC name is N-[(1S)-3-[3-(3,5-dimethyl-1,2,4-triazol-4-yl)-8-azatricyclo[3.2.1.01,4]octan-8-yl]-1-phenylpropyl]-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[(1S)-3-[3-(3,5-dimethyl-1,2,4-triazol-4-yl)-8-azatricyclo[3.2.1.01,4]octan-8-yl]-1-phenylpropyl]-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 176954031 |
| Molecular Formula | C27H35F2N5O |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | N-[(1S)-3-[3-(3,5-dimethyl-1,2,4-triazol-4-yl)-8-azatricyclo[3.2.1.01,4]octan-8-yl]-1-phenylpropyl]-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | Cc1nnc(C)n1C1CC23CCC(C12)N3CC[C@H](NC(=O)C1CCC(F)(F)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H35F2N5O/c1-17-31-32-18(2)34(17)23-16-26-12-10-22(24(23)26)33(26)15-11-21(19-6-4-3-5-7-19)30-25(35)20-8-13-27(28,29)14-9-20/h3-7,20-24H,8-16H2,1-2H3,(H,30,35)/t21-,22?,23?,24?,26?/m0/s1 |
| InChIKey | ABAFVWFTZIDXPR-WSHMSRCKSA-N |
| XLogP | 4.75 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |