C20H29F2NO3 — CID 143243544
N-[(1R)-5,5-dimethoxy-1-phenylpentyl]-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 143243544) has the molecular formula C20H29F2NO3 and a molecular weight of 369.45 g/mol. Its IUPAC name is N-[(1R)-5,5-dimethoxy-1-phenylpentyl]-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-[(1R)-5,5-dimethoxy-1-phenylpentyl]-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 143243544 |
| Molecular Formula | C20H29F2NO3 |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[(1R)-5,5-dimethoxy-1-phenylpentyl]-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | COC(CCC[C@@H](NC(=O)C1CCC(F)(F)CC1)c1ccccc1)OC |
| InChI | InChI=1S/C20H29F2NO3/c1-25-18(26-2)10-6-9-17(15-7-4-3-5-8-15)23-19(24)16-11-13-20(21,22)14-12-16/h3-5,7-8,16-18H,6,9-14H2,1-2H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | SMJHSJZKVAVDIM-QGZVFWFLSA-N |
| XLogP | 4.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|